|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GTP-CYCLOHYDRO-I-RXN GTP-CYCLOHYDRO-I-RXN] == | + | == Metabolite CPD-13665 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** gtp cyclohydrolase | + | ** n-acetyl-d-glucosamine 6-sulfate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/3.5.4.16 ec-3.5.4.16] | + | ** cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[GTP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[DIHYDRONEOPTERIN-P3]][c] '''+''' 1 [[FORMATE]][c] '''+''' 1 [[PROTON]][c]
| + | ** wjfveeaiyioath-rtrlpjtcsa-m |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ00877]] | + | ** 300.26 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[RXN-16512]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN-16512]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | == Reaction(s) of unknown directionality == |
| − | == Pathway(s) == | + | {{#set: common-name=n-acetyl-d-glucosamine 6-sulfate}} |
| − | * [[PWY0-1433]], tetrahydromonapterin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1433 PWY0-1433] | + | {{#set: inchi-key=inchikey=wjfveeaiyioath-rtrlpjtcsa-m}} |
| − | ** '''1''' reactions found over '''4''' reactions in the full pathway
| + | {{#set: molecular-weight=300.26}} |
| − | * [[PWY-7442]], drosopterin and aurodrosopterin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7442 PWY-7442]
| |
| − | ** '''3''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-6703]], preQ0 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6703 PWY-6703]
| |
| − | ** '''1''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7852]], 6-hydroxymethyl-dihydropterin diphosphate biosynthesis IV (Plasmodium): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7852 PWY-7852]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-6147]], 6-hydroxymethyl-dihydropterin diphosphate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6147 PWY-6147]
| |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-5664]], erythro-tetrahydrobiopterin biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5664 PWY-5664]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-6983]], threo-tetrahydrobiopterin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6983 PWY-6983] | |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-5663]], erythro-tetrahydrobiopterin biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5663 PWY-5663]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links ==
| |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17473 17473]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00424 R00424]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P19465 P19465]
| |
| − | ** [http://www.uniprot.org/uniprot/P22288 P22288]
| |
| − | ** [http://www.uniprot.org/uniprot/P43866 P43866]
| |
| − | ** [http://www.uniprot.org/uniprot/P51594 P51594]
| |
| − | ** [http://www.uniprot.org/uniprot/P64207 P64207]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CGE3 Q9CGE3]
| |
| − | ** [http://www.uniprot.org/uniprot/O66603 O66603]
| |
| − | ** [http://www.uniprot.org/uniprot/P56462 P56462]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A6T5 P0A6T5]
| |
| − | ** [http://www.uniprot.org/uniprot/P50141 P50141]
| |
| − | ** [http://www.uniprot.org/uniprot/P30793 P30793]
| |
| − | ** [http://www.uniprot.org/uniprot/P51601 P51601]
| |
| − | ** [http://www.uniprot.org/uniprot/Q05915 Q05915]
| |
| − | ** [http://www.uniprot.org/uniprot/P51597 P51597]
| |
| − | ** [http://www.uniprot.org/uniprot/P51600 P51600]
| |
| − | ** [http://www.uniprot.org/uniprot/Q94465 Q94465]
| |
| − | ** [http://www.uniprot.org/uniprot/Q55759 Q55759]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=gtp cyclohydrolase}} | |
| − | {{#set: ec-number=ec-3.5.4.16}}
| |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=8}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_nannochloropsis_salina|saccharina_japonica_genome}}
| |
