Difference between revisions of "CPD-13665"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE-MONOOXYGENASE-RXN SQUALENE-MONOOXYGENASE-RXN] == * direction: ** left-to-right * common-na...")
 
(Created page with "Category:metabolite == Metabolite CPD-13665 == * common-name: ** n-acetyl-d-glucosamine 6-sulfate * smiles: ** cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1) * inchi-key: **...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE-MONOOXYGENASE-RXN SQUALENE-MONOOXYGENASE-RXN] ==
+
== Metabolite CPD-13665 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** squalene,nadph:oxygen oxidoreductase (2,3-epoxidizing)
+
** n-acetyl-d-glucosamine 6-sulfate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.14.14.17 ec-1.14.14.17]
+
** cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1)
== Reaction formula ==
+
* inchi-key:
* 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[SQUALENE]][c] '''=>''' 1 [[EPOXYSQUALENE]][c] '''+''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[WATER]][c]
+
** wjfveeaiyioath-rtrlpjtcsa-m
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ00579]]
+
** 300.26
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-16512]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-16512]]
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-6098]], diploterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6098 PWY-6098]
+
{{#set: common-name=n-acetyl-d-glucosamine 6-sulfate}}
** '''2''' reactions found over '''2''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=wjfveeaiyioath-rtrlpjtcsa-m}}
* [[PWY-5670]], epoxysqualene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5670 PWY-5670]
+
{{#set: molecular-weight=300.26}}
** '''2''' reactions found over '''2''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21941 21941]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R02873 R02873]
 
** [http://www.genome.jp/dbget-bin/www_bget?R02874 R02874]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P52020 P52020]
 
** [http://www.uniprot.org/uniprot/P32476 P32476]
 
** [http://www.uniprot.org/uniprot/Q9T064 Q9T064]
 
** [http://www.uniprot.org/uniprot/O65829 O65829]
 
** [http://www.uniprot.org/uniprot/O65726 O65726]
 
** [http://www.uniprot.org/uniprot/O65727 O65727]
 
** [http://www.uniprot.org/uniprot/O65402 O65402]
 
** [http://www.uniprot.org/uniprot/O65403 O65403]
 
** [http://www.uniprot.org/uniprot/O65404 O65404]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=squalene,nadph:oxygen oxidoreductase (2,3-epoxidizing)}}
 
{{#set: ec-number=ec-1.14.14.17}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=2}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-13665

  • common-name:
    • n-acetyl-d-glucosamine 6-sulfate
  • smiles:
    • cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1)
  • inchi-key:
    • wjfveeaiyioath-rtrlpjtcsa-m
  • molecular-weight:
    • 300.26

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality