Difference between revisions of "CPD-13665"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cerotoyl-ACPs == * common-name: ** a cerotoyl-[acp] == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...") |
(Created page with "Category:metabolite == Metabolite CPD-13665 == * common-name: ** n-acetyl-d-glucosamine 6-sulfate * smiles: ** cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1) * inchi-key: **...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13665 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-d-glucosamine 6-sulfate |
| + | * smiles: | ||
| + | ** cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1) | ||
| + | * inchi-key: | ||
| + | ** wjfveeaiyioath-rtrlpjtcsa-m | ||
| + | * molecular-weight: | ||
| + | ** 300.26 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16512]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16512]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-d-glucosamine 6-sulfate}} |
| + | {{#set: inchi-key=inchikey=wjfveeaiyioath-rtrlpjtcsa-m}} | ||
| + | {{#set: molecular-weight=300.26}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-13665
- common-name:
- n-acetyl-d-glucosamine 6-sulfate
- smiles:
- cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1)
- inchi-key:
- wjfveeaiyioath-rtrlpjtcsa-m
- molecular-weight:
- 300.26
