Difference between revisions of "CPD-13665"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17347 == * common-name: ** (3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa * smiles: ** cccccc=ccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)...")
(Created page with "Category:metabolite == Metabolite Cerotoyl-ACPs == * common-name: ** a cerotoyl-[acp] == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17347 ==
+
== Metabolite Cerotoyl-ACPs ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa
+
** a cerotoyl-[acp]
* smiles:
 
** cccccc=ccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** mntslnsvzacncx-jpddaygwsa-j
 
* molecular-weight:
 
** 1069.99
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16096]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16095]]
+
* [[RXN-10062]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-(11z,14z)-icosa-11,14-dienoyl-coa}}
+
{{#set: common-name=a cerotoyl-[acp]}}
{{#set: inchi-key=inchikey=mntslnsvzacncx-jpddaygwsa-j}}
 
{{#set: molecular-weight=1069.99}}
 

Revision as of 18:57, 14 January 2021

Metabolite Cerotoyl-ACPs

  • common-name:
    • a cerotoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cerotoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.