Difference between revisions of "CPD-13667"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4961 RXN0-4961] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:metabolite == Metabolite CPD-13667 == * common-name: ** 11-oxo-β-amyrin * smiles: ** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c * i...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4961 RXN0-4961] ==
+
== Metabolite CPD-13667 ==
* direction:
+
* common-name:
** left-to-right
+
** 11-oxo-β-amyrin
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/3.1.11 ec-3.1.11]
+
** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c
== Reaction formula ==
+
* inchi-key:
* 1 [[DNA-N]][c] '''+''' n [[WATER]][c] '''=>''' n [[Nucleoside-Monophosphates]][c]
+
** ukaiybgrlwqhdq-vcuiepqisa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ20310]]
+
** 440.708
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-13492]]
* Gene: [[SJ03071]]
+
* [[RXN-13506]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) ==
+
{{#set: common-name=11-oxo-β-amyrin}}
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=ukaiybgrlwqhdq-vcuiepqisa-n}}
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=440.708}}
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-3.1.11}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-13667

  • common-name:
    • 11-oxo-β-amyrin
  • smiles:
    • cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c
  • inchi-key:
    • ukaiybgrlwqhdq-vcuiepqisa-n
  • molecular-weight:
    • 440.708

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality