Difference between revisions of "CPD-13667"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4733 RXN-4733] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/2....")
(Created page with "Category:metabolite == Metabolite CPD-13667 == * common-name: ** 11-oxo-β-amyrin * smiles: ** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c * i...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4733 RXN-4733] ==
+
== Metabolite CPD-13667 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** 11-oxo-β-amyrin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.4.1 ec-2.4.1]
+
** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-12575]][c] '''+''' 1 [[CPD-4441]][c] '''=>''' 1 [[CPD-4618]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c]
+
** ukaiybgrlwqhdq-vcuiepqisa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ06217]]
+
** 440.708
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-13492]]
−
== Pathway(s) ==
+
* [[RXN-13506]]
−
* [[PWY-2881]], cytokinins 7-N-glucoside biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2881 PWY-2881]
+
== Reaction(s) known to produce the compound ==
−
** '''1''' reactions found over '''7''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=11-oxo-β-amyrin}}
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=ukaiybgrlwqhdq-vcuiepqisa-n}}
−
== External links  ==
+
{{#set: molecular-weight=440.708}}
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-2.4.1}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-13667

  • common-name:
    • 11-oxo-β-amyrin
  • smiles:
    • cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c
  • inchi-key:
    • ukaiybgrlwqhdq-vcuiepqisa-n
  • molecular-weight:
    • 440.708

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13667&oldid=139217"