Difference between revisions of "CPD-13667"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4733 RXN-4733] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/2....") |
(Created page with "Category:metabolite == Metabolite CPD-13667 == * common-name: ** 11-oxo-β-amyrin * smiles: ** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c * i...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-13667 == |
− | * | + | * common-name: |
− | ** | + | ** 11-oxo-β-amyrin |
− | * | + | * smiles: |
− | ** | + | ** cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c |
− | == | + | * inchi-key: |
− | + | ** ukaiybgrlwqhdq-vcuiepqisa-n | |
− | + | * molecular-weight: | |
− | * | + | ** 440.708 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[RXN-13492]] |
− | == | + | * [[RXN-13506]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | {{#set: common-name=11-oxo-β-amyrin}} |
− | + | {{#set: inchi-key=inchikey=ukaiybgrlwqhdq-vcuiepqisa-n}} | |
− | == | + | {{#set: molecular-weight=440.708}} |
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-13667
- common-name:
- 11-oxo-β-amyrin
- smiles:
- cc3(cc4(c2(=cc(=o)c5(c1(ccc(c(c1ccc(c2(ccc(cc3)4c)c)5c)(c)c)o)c))))c
- inchi-key:
- ukaiybgrlwqhdq-vcuiepqisa-n
- molecular-weight:
- 440.708