Difference between revisions of "CPD-13670"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Hepta-oxo-hexadecanoyl-ACPs == * common-name: ** a 3,5,7,9,11,13,15-hepta-oxo-hexadecanoyl-[pks-acp] == Reaction(s) known to consume the...") |
(Created page with "Category:metabolite == Metabolite CPD-14154 == * common-name: ** tobramycin * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-14154 == |
* common-name: | * common-name: | ||
− | ** | + | ** tobramycin |
+ | * smiles: | ||
+ | ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o) | ||
+ | * inchi-key: | ||
+ | ** nlvfbuxfdbbnbw-pbsuhmdjsa-s | ||
+ | * molecular-weight: | ||
+ | ** 472.558 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13168]] |
+ | * [[RXN-15284]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=tobramycin}} |
+ | {{#set: inchi-key=inchikey=nlvfbuxfdbbnbw-pbsuhmdjsa-s}} | ||
+ | {{#set: molecular-weight=472.558}} |
Revision as of 11:12, 15 January 2021
Contents
Metabolite CPD-14154
- common-name:
- tobramycin
- smiles:
- c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o)
- inchi-key:
- nlvfbuxfdbbnbw-pbsuhmdjsa-s
- molecular-weight:
- 472.558