Difference between revisions of "CPD-13670"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19982 == * transcription-direction: ** positive * right-end-position: ** 143128 * left-end-position: ** 140883 * centisome-position: ** 65.08200...")
(Created page with "Category:metabolite == Metabolite CPD-13670 == * common-name: ** 30-hydroxy-11-oxo-β-amyrin * smiles: ** cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ19982 ==
+
== Metabolite CPD-13670 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 30-hydroxy-11-oxo-β-amyrin
−
* right-end-position:
+
* smiles:
−
** 143128
+
** cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c))c)c))c)o)c
−
* left-end-position:
+
* inchi-key:
−
** 140883
+
** jcgxiyqlryphdg-zbyjljtqsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 65.08200   
+
** 456.707
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-13493]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-13492]]
−
* [[1.1.1.145-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=30-hydroxy-11-oxo-&beta;-amyrin}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=jcgxiyqlryphdg-zbyjljtqsa-n}}
−
* [[RXN-12693]]
+
{{#set: molecular-weight=456.707}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12747]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12789]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-342]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-350]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-353]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6946]]
 
−
** '''6''' reactions found over '''22''' reactions in the full pathway
 
−
* [[PWY-6944]]
 
−
** '''2''' reactions found over '''25''' reactions in the full pathway
 
−
* [[PWY-6948]]
 
−
** '''2''' reactions found over '''18''' reactions in the full pathway
 
−
* [[PWY66-378]]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-7299]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-4861]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY-6415]]
 
−
** '''4''' reactions found over '''7''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=143128}}
 
−
{{#set: left-end-position=140883}}
 
−
{{#set: centisome-position=65.08200    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=8}}
 
−
{{#set: nb pathway associated=7}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-13670

  • common-name:
    • 30-hydroxy-11-oxo-β-amyrin
  • smiles:
    • cc1(c(ccc2(c3(c(ccc12)(c4(c(=cc(=o)3)c5(c(cc4)(ccc(c5)(co)c)c))c)c))c)o)c
  • inchi-key:
    • jcgxiyqlryphdg-zbyjljtqsa-n
  • molecular-weight:
    • 456.707

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13670&oldid=136740"