Difference between revisions of "CPD-13700"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-114 == * common-name: ** all-trans-lycopene * smiles: ** cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c * in...")
(Created page with "Category:metabolite == Metabolite CPD-13700 == * common-name: ** 3-oxo-4-pregnene-20-carboxyl-coa * smiles: ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-114 ==
+
== Metabolite CPD-13700 ==
 
* common-name:
 
* common-name:
** all-trans-lycopene
+
** 3-oxo-4-pregnene-20-carboxyl-coa
 
* smiles:
 
* smiles:
** cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c
+
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])[ch]6(cc[ch]7([ch]5(ccc4(=cc(=o)ccc(c)4[ch]5ccc(c)67))))
 
* inchi-key:
 
* inchi-key:
** oaijszizwzsqbc-gyzmgtaesa-n
+
** cjjbducnumwujx-zktjokcmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 536.882
+
** 1089.98
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1F-150]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8042]]
+
* [[RXN-12710]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=all-trans-lycopene}}
+
{{#set: common-name=3-oxo-4-pregnene-20-carboxyl-coa}}
{{#set: inchi-key=inchikey=oaijszizwzsqbc-gyzmgtaesa-n}}
+
{{#set: inchi-key=inchikey=cjjbducnumwujx-zktjokcmsa-j}}
{{#set: molecular-weight=536.882}}
+
{{#set: molecular-weight=1089.98}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-13700

  • common-name:
    • 3-oxo-4-pregnene-20-carboxyl-coa
  • smiles:
    • cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])[ch]6(cc[ch]7([ch]5(ccc4(=cc(=o)ccc(c)4[ch]5ccc(c)67))))
  • inchi-key:
    • cjjbducnumwujx-zktjokcmsa-j
  • molecular-weight:
    • 1089.98

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality