Difference between revisions of "CPD-13713"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GUANIDOACETIC_ACID == * common-name: ** guanidinoacetate * smiles: ** c(nc(n)=[n+])c([o-])=o * inchi-key: ** bpmfzumjyqtvii-uhfffaoysa-n...") |
(Created page with "Category:metabolite == Metabolite CPD-13713 == * common-name: ** adenosine 5'-phosphoselenate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])o[se](...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13713 == |
* common-name: | * common-name: | ||
| − | ** | + | ** adenosine 5'-phosphoselenate |
* smiles: | * smiles: | ||
| − | ** c(nc | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])o[se](=o)(=o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xcadvmzzfpierr-kqynxxcusa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 473.174 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12720]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=adenosine 5'-phosphoselenate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xcadvmzzfpierr-kqynxxcusa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=473.174}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-13713
- common-name:
- adenosine 5'-phosphoselenate
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])o[se](=o)(=o)o
- inchi-key:
- xcadvmzzfpierr-kqynxxcusa-m
- molecular-weight:
- 473.174
