Difference between revisions of "CPD-13717"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07547 == * transcription-direction: ** negative * right-end-position: ** 73061 * left-end-position: ** 72435 * centisome-position: ** 15.9546 =...") |
(Created page with "Category:metabolite == Metabolite CPD-13717 == * common-name: ** l-selenocystathionine * smiles: ** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-] * inchi-key: ** znwydqpouqrdl...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-13717 == |
| − | * | + | * common-name: |
| − | ** | + | ** l-selenocystathionine |
| − | * | + | * smiles: |
| − | ** | + | ** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** znwydqpouqrdly-whfbiakzsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 269.159 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-12729]] |
| − | == Reaction(s) | + | * [[RXN-15137]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | ** | + | * [[ACHMSSELCYSL]] |
| − | * | + | * [[ACHMSSELCYSLh]] |
| − | {{#set: | + | * [[RXN-12728]] |
| − | {{#set: | + | * [[SUCHMSSELCYSL]] |
| − | + | * [[SUCHMSSELCYSLh]] | |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=l-selenocystathionine}} | |
| − | + | {{#set: inchi-key=inchikey=znwydqpouqrdly-whfbiakzsa-n}} | |
| + | {{#set: molecular-weight=269.159}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-13717
- common-name:
- l-selenocystathionine
- smiles:
- c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-]
- inchi-key:
- znwydqpouqrdly-whfbiakzsa-n
- molecular-weight:
- 269.159
