Difference between revisions of "CPD-13717"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Supercoiled-Duplex-DNAs == * common-name: ** a supercoiled duplex dna == Reaction(s) known to consume the compound == * RXN0-4261 ==...")
(Created page with "Category:metabolite == Metabolite CPD-13717 == * common-name: ** l-selenocystathionine * smiles: ** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-] * inchi-key: ** znwydqpouqrdl...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Supercoiled-Duplex-DNAs ==
+
== Metabolite CPD-13717 ==
 
* common-name:
 
* common-name:
** a supercoiled duplex dna
+
** l-selenocystathionine
 +
* smiles:
 +
** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-]
 +
* inchi-key:
 +
** znwydqpouqrdly-whfbiakzsa-n
 +
* molecular-weight:
 +
** 269.159
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-4261]]
+
* [[RXN-12729]]
 +
* [[RXN-15137]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ACHMSSELCYSL]]
 +
* [[ACHMSSELCYSLh]]
 +
* [[RXN-12728]]
 +
* [[SUCHMSSELCYSL]]
 +
* [[SUCHMSSELCYSLh]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a supercoiled duplex dna}}
+
{{#set: common-name=l-selenocystathionine}}
 +
{{#set: inchi-key=inchikey=znwydqpouqrdly-whfbiakzsa-n}}
 +
{{#set: molecular-weight=269.159}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-13717

  • common-name:
    • l-selenocystathionine
  • smiles:
    • c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-]
  • inchi-key:
    • znwydqpouqrdly-whfbiakzsa-n
  • molecular-weight:
    • 269.159

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality