Difference between revisions of "CPD-13758"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1404 RXN-1404] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/3....")
(Created page with "Category:metabolite == Metabolite NOREPINEPHRINE == * common-name: ** (r)-noradrenaline * smiles: ** c1(c=c(o)c(=cc=1c(c[n+])o)o) * inchi-key: ** sflshlfxelfnjz-qmmmgpobsa...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1404 RXN-1404] ==
+
== Metabolite NOREPINEPHRINE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** (r)-noradrenaline
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.5.5.1 ec-3.5.5.1]
+
** c1(c=c(o)c(=cc=1c(c[n+])o)o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[INDOLEYL-CPD]][c] '''+''' 2 [[WATER]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[INDOLE_ACETATE_AUXIN]][c]
+
** sflshlfxelfnjz-qmmmgpobsa-o
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ14362]]
+
** 170.188
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-10907]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ02846]]
+
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=(r)-noradrenaline}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=sflshlfxelfnjz-qmmmgpobsa-o}}
−
== Pathway(s) ==
+
{{#set: molecular-weight=170.188}}
−
* [[PWY-5026]], indole-3-acetate biosynthesis V (bacteria and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5026 PWY-5026]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY-581]], indole-3-acetate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-581 PWY-581]
 
−
** '''5''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWYQT-4476]], indole glucosinolate activation (herbivore attack): [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4476 PWYQT-4476]
 
−
** '''1''' reactions found over '''13''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=45777 45777]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R03093 R03093]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-3.5.5.1}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=3}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana}}
 

Revision as of 20:36, 18 December 2020

Metabolite NOREPINEPHRINE

  • common-name:
    • (r)-noradrenaline
  • smiles:
    • c1(c=c(o)c(=cc=1c(c[n+])o)o)
  • inchi-key:
    • sflshlfxelfnjz-qmmmgpobsa-o
  • molecular-weight:
    • 170.188

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13758&oldid=47815"