Difference between revisions of "CPD-13793"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CELLOBIOSE == * common-name: ** β-d-cellobiose * smiles: ** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o * inchi-key: ** gubgytab...")
(Created page with "Category:metabolite == Metabolite Bleomycins == * common-name: ** a bleomycin == Reaction(s) known to consume the compound == * 3.4.22.40-RXN == Reaction(s) known to p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CELLOBIOSE ==
+
== Metabolite Bleomycins ==
 
* common-name:
 
* common-name:
** β-d-cellobiose
+
** a bleomycin
* smiles:
 
** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o
 
* inchi-key:
 
** gubgytabksrvrq-qrzgkkjrsa-n
 
* molecular-weight:
 
** 342.299
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10773]]
+
* [[3.4.22.40-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.2.1.91-RXN]]
 
* [[RXN-12305]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-cellobiose}}
+
{{#set: common-name=a bleomycin}}
{{#set: inchi-key=inchikey=gubgytabksrvrq-qrzgkkjrsa-n}}
 
{{#set: molecular-weight=342.299}}
 

Revision as of 15:30, 5 January 2021

Metabolite Bleomycins

  • common-name:
    • a bleomycin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality