Difference between revisions of "CPD-13851"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cis-Delta7-tetradecenoyl-ACPs == * common-name: ** a cis-δ7-tetradecenoyl-[acp] == Reaction(s) known to consume the compound == * [...") |
(Created page with "Category:metabolite == Metabolite CPD-13851 == * common-name: ** 2-hydroxy-datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-13851 == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-hydroxy-datp |
+ | * smiles: | ||
+ | ** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o | ||
+ | * inchi-key: | ||
+ | ** uoacbprdwrdehj-kvqbguixsa-j | ||
+ | * molecular-weight: | ||
+ | ** 503.152 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-6957]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-hydroxy-datp}} |
+ | {{#set: inchi-key=inchikey=uoacbprdwrdehj-kvqbguixsa-j}} | ||
+ | {{#set: molecular-weight=503.152}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-13851
- common-name:
- 2-hydroxy-datp
- smiles:
- c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
- inchi-key:
- uoacbprdwrdehj-kvqbguixsa-j
- molecular-weight:
- 503.152