Difference between revisions of "CPD-13851"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-701 RXN-701] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/1.8.1 e...") |
(Created page with "Category:metabolite == Metabolite CPD-13851 == * common-name: ** 2-hydroxy-datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-13851 == |
| − | * | + | * common-name: |
| − | ** | + | ** 2-hydroxy-datp |
| − | * | + | * smiles: |
| − | ** | + | ** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o |
| − | == | + | * inchi-key: |
| − | + | ** uoacbprdwrdehj-kvqbguixsa-j | |
| − | + | * molecular-weight: | |
| − | == | + | ** 503.152 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | * | + | * [[RXN0-6957]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=2-hydroxy-datp}} | |
| − | + | {{#set: inchi-key=inchikey=uoacbprdwrdehj-kvqbguixsa-j}} | |
| − | + | {{#set: molecular-weight=503.152}} | |
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-13851
- common-name:
- 2-hydroxy-datp
- smiles:
- c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
- inchi-key:
- uoacbprdwrdehj-kvqbguixsa-j
- molecular-weight:
- 503.152
