|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2381 RXN0-2381] == | + | == Metabolite CPD-13851 == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** indoleglycerol phosphate aldolase | + | ** 2-hydroxy-datp |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/4.1.2.8 ec-4.1.2.8] | + | ** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[INDOLE-3-GLYCEROL-P]][c] '''<=>''' 1 [[GAP]][c] '''+''' 1 [[INDOLE]][c]
| + | ** uoacbprdwrdehj-kvqbguixsa-j |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ20325]]
| + | ** 503.152 |
| − | ** Category: [[orthology]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN0-6957]] |
| − | * Gene: [[SJ09991]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: common-name=2-hydroxy-datp}} |
| − | ** Category: [[orthology]]
| + | {{#set: inchi-key=inchikey=uoacbprdwrdehj-kvqbguixsa-j}} |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | {{#set: molecular-weight=503.152}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | * Gene: [[SJ16706]] | |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ15468]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ10955]]
| |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[TRPSYN-PWY]], L-tryptophan biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRPSYN-PWY TRPSYN-PWY] | |
| − | ** '''6''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-6949]], DIBOA-glucoside biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6949 PWY-6949]
| |
| − | ** '''1''' reactions found over '''6''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14084 14084]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R02340 R02340]
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=indoleglycerol phosphate aldolase}} | |
| − | {{#set: ec-number=ec-4.1.2.8}}
| |
| − | {{#set: nb gene associated=5}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=orthology|annotation}} | |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_nannochloropsis_salina|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
