Difference between revisions of "CPD-13851"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7087 == * common-name: ** (+)-dihydromyricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite 23S-rRNA-adenine-1618 == * common-name: ** adenine1618 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11596 == Rea...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 23S-rRNA-adenine-1618 == |
* common-name: | * common-name: | ||
− | ** | + | ** adenine1618 in 23s rrna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11596]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=adenine1618 in 23s rrna}} |
− | |||
− |
Revision as of 15:29, 5 January 2021
Contents
Metabolite 23S-rRNA-adenine-1618
- common-name:
- adenine1618 in 23s rrna