Difference between revisions of "CPD-13853"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite IMINOASPARTATE == * common-name: ** 2-iminosuccinate * smiles: ** c(=o)([o-])cc(=n)c(=o)[o-] * inchi-key: ** nmuoatvllqeyhi-uhfffaoysa-l...") |
(Created page with "Category:metabolite == Metabolite Alpha-hydroxyphytoceramides == * common-name: ** a (2'r)-2'-hydroxy-phytoceramide == Reaction(s) known to consume the compound == * RXN...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Alpha-hydroxyphytoceramides == |
* common-name: | * common-name: | ||
| − | ** 2 | + | ** a (2'r)-2'-hydroxy-phytoceramide |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN3O-581]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=2- | + | {{#set: common-name=a (2'r)-2'-hydroxy-phytoceramide}} |
| − | |||
| − | |||
Revision as of 18:58, 14 January 2021
Contents
Metabolite Alpha-hydroxyphytoceramides
- common-name:
- a (2'r)-2'-hydroxy-phytoceramide
