|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN] == | + | == Metabolite CPD-13855 == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** hydroxymethyl glutaryl-coa synthase | + | ** n7-methylguanosine 5'-diphosphate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.3.3.10 ec-2.3.3.10] | + | ** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])([o-])=o)c(o)c(o)3)) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ACETOACETYL-COA]][c] '''+''' 1 [[ACETYL-COA]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[3-HYDROXY-3-METHYL-GLUTARYL-COA]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[PROTON]][c]
| + | ** sbasprrecyvbrf-kqynxxcusa-l |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ06617]] | + | ** 455.214 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[RXN-12817]] |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN-12817]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ11593]]
| + | {{#set: common-name=n7-methylguanosine 5'-diphosphate}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=sbasprrecyvbrf-kqynxxcusa-l}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: molecular-weight=455.214}} |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | == Pathway(s) == | |
| − | * [[PWY-7391]], isoprene biosynthesis II (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7391 PWY-7391] | |
| − | ** '''7''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-7524]], mevalonate pathway III (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7524 PWY-7524]
| |
| − | ** '''5''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-922]], mevalonate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-922 PWY-922]
| |
| − | ** '''7''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-6174]], mevalonate pathway II (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6174 PWY-6174]
| |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY66-367]], ketogenesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-367 PWY66-367]
| |
| − | ** '''4''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-7571]], ferrichrome A biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7571 PWY-7571] | |
| − | ** '''1''' reactions found over '''5''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links ==
| |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10191 10191]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01978 R01978]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P13704 P13704]
| |
| − | ** [http://www.uniprot.org/uniprot/P22791 P22791]
| |
| − | ** [http://www.uniprot.org/uniprot/P54870 P54870]
| |
| − | ** [http://www.uniprot.org/uniprot/P54869 P54869]
| |
| − | ** [http://www.uniprot.org/uniprot/O51626 O51626]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CFA9 Q9CFA9]
| |
| − | ** [http://www.uniprot.org/uniprot/P17425 P17425]
| |
| − | ** [http://www.uniprot.org/uniprot/Q7LZE7 Q7LZE7]
| |
| − | ** [http://www.uniprot.org/uniprot/Q01581 Q01581]
| |
| − | ** [http://www.uniprot.org/uniprot/P54961 P54961]
| |
| − | ** [http://www.uniprot.org/uniprot/P54839 P54839]
| |
| − | ** [http://www.uniprot.org/uniprot/P54874 P54874]
| |
| − | ** [http://www.uniprot.org/uniprot/P54868 P54868]
| |
| − | ** [http://www.uniprot.org/uniprot/P54873 P54873]
| |
| − | ** [http://www.uniprot.org/uniprot/P93773 P93773]
| |
| − | </div>
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=hydroxymethyl glutaryl-coa synthase}} | |
| − | {{#set: ec-number=ec-2.3.3.10}} | |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=6}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana|saccharina_japonica_genome}}
| |
