Difference between revisions of "CPD-13855"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Pi == * common-name: ** phosphate * smiles: ** [o-]p(=o)(o)[o-] * inchi-key: ** nbiixxvuzaflbc-uhfffaoysa-l * molecular-weight: ** 95.979...")
(Created page with "Category:metabolite == Metabolite CPD-15677 == * common-name: ** 4-trans-undecenoyl-coa * smiles: ** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Pi ==
+
== Metabolite CPD-15677 ==
 
* common-name:
 
* common-name:
** phosphate
+
** 4-trans-undecenoyl-coa
 
* smiles:
 
* smiles:
** [o-]p(=o)(o)[o-]
+
** ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** nbiixxvuzaflbc-uhfffaoysa-l
+
** afmmiiqkxqnedn-dupkwvsksa-j
 
* molecular-weight:
 
* molecular-weight:
** 95.979
+
** 929.765
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-14789]]
* [[2.5.1.19-RXN]]
 
* [[2.7.1.90-RXN]]
 
* [[2.7.7.8-RXN]]
 
* [[3.6.1.52-RXN]]
 
* [[3.6.4.5-RXN]]
 
* [[5.99.1.3-RXN]]
 
* [[ACOACXr]]
 
* [[ADENPHOSPHOR-RXN]]
 
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 
* [[ASPCARBTRANS-RXN]]
 
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 
* [[ATPSYN-RXN]]
 
* [[Cut1]]
 
* [[DAHPSYN-RXN]]
 
* [[DAMPH]]
 
* [[DEOXYADENPHOSPHOR-RXN]]
 
* [[DEOXYGUANPHOSPHOR-RXN]]
 
* [[DEOXYINOPHOSPHOR-RXN]]
 
* [[DMPH]]
 
* [[DOLICHYLDIPHOSPHATASE-RXN]]
 
* [[FORMATETHFLIG-RXN]]
 
* [[GAPDHSYNEC-RXN]]
 
* [[GAPDH_]]
 
* [[GAPOXNPHOSPHN-RXN]]
 
* [[GLYCOPHOSPHORYL-RXN]]
 
* [[GLYMALTOPHOSPHORYL-RXN]]
 
* [[INOPHOSPHOR-RXN]]
 
* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
 
* [[M5TAP]]
 
* [[MANNPGUANYLTRANGDP-RXN]]
 
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
* [[ORNCARBAMTRANSFER-RXN]]
 
* [[PCr]]
 
* [[PEPPIth]]
 
* [[PHOSACETYLTRANS-RXN]]
 
* [[PINA1th]]
 
* [[PINA1tm]]
 
* [[PItm]]
 
* [[PNP-RXN]]
 
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 
* [[R163-RXN]]
 
* [[RXN-10963]]
 
* [[RXN-10965]]
 
* [[RXN-10975]]
 
* [[RXN-10976]]
 
* [[RXN-10977]]
 
* [[RXN-10978]]
 
* [[RXN-11715]]
 
* [[RXN-11743]]
 
* [[RXN-12171]]
 
* [[RXN-12392]]
 
* [[RXN-12486]]
 
* [[RXN-13139]]
 
* [[RXN-13482]]
 
* [[RXN-14029]]
 
* [[RXN-14205]]
 
* [[RXN-14284]]
 
* [[RXN-14285]]
 
* [[RXN-14286]]
 
* [[RXN-14353]]
 
* [[RXN-15703]]
 
* [[RXN-16030]]
 
* [[RXN-16294]]
 
* [[RXN-1826]]
 
* [[RXN-4311]]
 
* [[RXN-9025]]
 
* [[RXN0-1061]]
 
* [[RXN0-3542]]
 
* [[RXN0-5182]]
 
* [[RXN0-5184]]
 
* [[RXN0-5199]]
 
* [[RXN8J2-139]]
 
* [[RXNQT-4141]]
 
* [[SUCCCOASYN-RXN]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
* [[SULFATE-ADENYLYLTRANSFERASE-ADP-RXN]]
 
* [[TRANS-RXN0-470]]
 
* [[URA-PHOSPH-RXN]]
 
* [[URPHOS-RXN]]
 
* [[XANTHOSINEPHOSPHORY-RXN]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-14788]]
* [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]]
 
* [[2.5.1.19-RXN]]
 
* [[2.7.1.90-RXN]]
 
* [[2.7.7.8-RXN]]
 
* [[2.7.9.3-RXN]]
 
* [[3-DEHYDROQUINATE-SYNTHASE-RXN]]
 
* [[3.1.3.16-RXN]]
 
* [[3.1.3.43-RXN]]
 
* [[3.1.3.46-RXN]]
 
* [[3.1.3.56-RXN]]
 
* [[3.1.3.57-RXN]]
 
* [[3.1.3.66-RXN]]
 
* [[3.1.3.67-RXN]]
 
* [[3.1.3.68-RXN]]
 
* [[3.1.3.74-RXN]]
 
* [[3.6.1.52-RXN]]
 
* [[3.6.3.1-RXN]]
 
* [[3.6.3.12-RXN]]
 
* [[3.6.3.16-RXN]]
 
* [[3.6.3.30-RXN]]
 
* [[3.6.3.31-RXN]]
 
* [[3.6.3.35-RXN]]
 
* [[3.6.3.37-RXN]]
 
* [[3.6.3.4-RXN]]
 
* [[3.6.3.43-RXN]]
 
* [[3.6.3.44-RXN]]
 
* [[3.6.3.6-RXN]]
 
* [[3.6.3.8-RXN]]
 
* [[3.6.3.9-RXN]]
 
* [[3.6.4.3-RXN]]
 
* [[3.6.4.4-RXN]]
 
* [[3.6.4.5-RXN]]
 
* [[3.6.4.6-RXN]]
 
* [[3.6.4.7-RXN]]
 
* [[325-BISPHOSPHATE-NUCLEOTIDASE-RXN]]
 
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
 
* [[4.2.1.93-RXN]]
 
* [[5-FORMYL-THF-CYCLO-LIGASE-RXN]]
 
* [[5-NUCLEOTID-RXN]]
 
* [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]]
 
* [[5.99.1.3-RXN]]
 
* [[6.3.2.25-RXN]]
 
* [[6.3.5.6-RXN]]
 
* [[6.3.5.7-RXN]]
 
* [[ABC-24-RXN]]
 
* [[ABC-25-RXN]]
 
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 
* [[ACID-PHOSPHATASE-RXN]]
 
* [[ACYLPHOSPHATASE-RXN]]
 
* [[ADENPHOSPHOR-RXN]]
 
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
 
* [[AIRS-RXN]]
 
* [[ALKAPHOSPHA-RXN]]
 
* [[AMP-DEPHOSPHORYLATION-RXN]]
 
* [[AMP5N]]
 
* [[APYRASE-RXN]]
 
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 
* [[ASPCARBTRANS-RXN]]
 
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 
* [[ATPASE-RXN]]
 
* [[ATPCL]]
 
* [[ATPSYN-RXN]]
 
* [[BIOTIN-CARBOXYL-RXN]]
 
* [[CARBPSYN-RXN]]
 
* [[CHORISMATE-SYNTHASE-RXN]]
 
* [[CTPSYN-RXN]]
 
* [[CYSPH-RXN]]
 
* [[DAHPSYN-RXN]]
 
* [[DALADALALIG-RXN]]
 
* [[DAMPH]]
 
* [[DEOXYADENPHOSPHOR-RXN]]
 
* [[DEOXYGUANPHOSPHOR-RXN]]
 
* [[DEOXYINOPHOSPHOR-RXN]]
 
* [[DETHIOBIOTIN-SYN-RXN]]
 
* [[DIHYDROFOLATESYNTH-RXN]]
 
* [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]]
 
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
 
* [[DMPH]]
 
* [[DOLICHYLDIPHOSPHATASE-RXN]]
 
* [[EXOPOLYPHOSPHATASE-RXN]]
 
* [[F16BDEPHOS-RXN]]
 
* [[FE2GTPabc]]
 
* [[FE3abch]]
 
* [[FGAMSYN-RXN]]
 
* [[FOLYLPOLYGLUTAMATESYNTH-RXN]]
 
* [[FORMATETHFLIG-RXN]]
 
* [[FORMYLTHFGLUSYNTH-RXN]]
 
* [[FTHFL]]
 
* [[G5DH]]
 
* [[G5DHm]]
 
* [[GAPDHSYNEC-RXN]]
 
* [[GAPDH_]]
 
* [[GAPOXNPHOSPHN-RXN]]
 
* [[GLUTAMINESYN-RXN]]
 
* [[GLUTATHIONE-SYN-RXN]]
 
* [[GLUTCYSLIG-RXN]]
 
* [[GLUTSEMIALDEHYDROG-RXN]]
 
* [[GLYCEROL-1-PHOSPHATASE-RXN]]
 
* [[GLYRIBONUCSYN-RXN]]
 
* [[GPH-RXN]]
 
* [[GUANOSINE-DIPHOSPHATASE-RXN]]
 
* [[HISTIDPHOS-RXN]]
 
* [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
 
* [[I5NT]]
 
* [[INOPHOSPHOR-RXN]]
 
* [[INORGPYROPHOSPHAT-RXN]]
 
* [[LUMAZINESYN-RXN]]
 
* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
 
* [[MANNITOL-1-PHOSPHATASE-RXN]]
 
* [[MANNPGUANYLTRANGDP-RXN]]
 
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
 
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
 
* [[NUCLEOSIDE-DIPHOSPHATASE-RXN]]
 
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 
* [[NUCLEOTIDASE-RXN]]
 
* [[ORNCARBAMTRANSFER-RXN]]
 
* [[PCr]]
 
* [[PEPCARBOX-RXN]]
 
* [[PEPPIth]]
 
* [[PGPPHOSPHA-RXN]]
 
* [[PHOSACETYLTRANS-RXN]]
 
* [[PHOSPHATIDATE-PHOSPHATASE-RXN]]
 
* [[PHOSPHATIDATE-PHOSPHATASE-RXN-CPD0-1422/WATER//CPD66-34/Pi.29.]]
 
* [[PHOSPHATIDYLINOSITOL-3-PHOSPHATASE-RXN]]
 
* [[PHOSPHATIDYLINOSITOL-BISPHOSPHATASE-RXN]]
 
* [[PINA1th]]
 
* [[PINA1tm]]
 
* [[PItm]]
 
* [[PNP-RXN]]
 
* [[POLYNUCLEOTIDE-3-PHOSPHATASE-RXN]]
 
* [[POLYNUCLEOTIDE-5-PHOSPHATASE-RXN]]
 
* [[PPC]]
 
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 
* [[PSERPHOSPHA-RXN]]
 
* [[PYAMPP]]
 
* [[PYRUVATE-CARBOXYLASE-RXN]]
 
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 
* [[QUINOLINATE-SYNTHA-RXN]]
 
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
 
* [[R163-RXN]]
 
* [[RXN-10036]]
 
* [[RXN-10039]]
 
* [[RXN-10862]]
 
* [[RXN-10939]]
 
* [[RXN-10947]]
 
* [[RXN-10949]]
 
* [[RXN-10952]]
 
* [[RXN-10953]]
 
* [[RXN-10954]]
 
* [[RXN-10958]]
 
* [[RXN-10959]]
 
* [[RXN-10960]]
 
* [[RXN-10963]]
 
* [[RXN-10964]]
 
* [[RXN-10965]]
 
* [[RXN-10975]]
 
* [[RXN-10976]]
 
* [[RXN-10977]]
 
* [[RXN-10978]]
 
* [[RXN-11109]]
 
* [[RXN-11135]]
 
* [[RXN-11136]]
 
* [[RXN-11277]]
 
* [[RXN-11322]]
 
* [[RXN-12195]]
 
* [[RXN-12196]]
 
* [[RXN-12197]]
 
* [[RXN-12198]]
 
* [[RXN-12199]]
 
* [[RXN-12200]]
 
* [[RXN-12486]]
 
* [[RXN-12590]]
 
* [[RXN-12728]]
 
* [[RXN-12816]]
 
* [[RXN-13139]]
 
* [[RXN-13202]]
 
* [[RXN-13313]]
 
* [[RXN-13482]]
 
* [[RXN-14003]]
 
* [[RXN-14024]]
 
* [[RXN-14025]]
 
* [[RXN-14026]]
 
* [[RXN-14029]]
 
* [[RXN-14046]]
 
* [[RXN-14125]]
 
* [[RXN-14143]]
 
* [[RXN-14181]]
 
* [[RXN-14187]]
 
* [[RXN-14195]]
 
* [[RXN-14198]]
 
* [[RXN-14199]]
 
* [[RXN-14200]]
 
* [[RXN-14201]]
 
* [[RXN-14205]]
 
* [[RXN-14208]]
 
* [[RXN-14213]]
 
* [[RXN-14214]]
 
* [[RXN-14215]]
 
* [[RXN-14216]]
 
* [[RXN-14217]]
 
* [[RXN-14218]]
 
* [[RXN-14219]]
 
* [[RXN-14220]]
 
* [[RXN-14227]]
 
* [[RXN-14325]]
 
* [[RXN-14455]]
 
* [[RXN-14473]]
 
* [[RXN-14552]]
 
* [[RXN-14964]]
 
* [[RXN-14965]]
 
* [[RXN-15006]]
 
* [[RXN-15284]]
 
* [[RXN-15285]]
 
* [[RXN-15287]]
 
* [[RXN-15312]]
 
* [[RXN-15703]]
 
* [[RXN-15712]]
 
* [[RXN-16030]]
 
* [[RXN-16121]]
 
* [[RXN-16291]]
 
* [[RXN-16292]]
 
* [[RXN-16293]]
 
* [[RXN-16294]]
 
* [[RXN-16910]]
 
* [[RXN-16991]]
 
* [[RXN-17131]]
 
* [[RXN-17132]]
 
* [[RXN-17133]]
 
* [[RXN-17730]]
 
* [[RXN-17924]]
 
* [[RXN-17947]]
 
* [[RXN-17948]]
 
* [[RXN-4311]]
 
* [[RXN-5647]]
 
* [[RXN-5822]]
 
* [[RXN-5841]]
 
* [[RXN-6341]]
 
* [[RXN-7241]]
 
* [[RXN-7253]]
 
* [[RXN-7607]]
 
* [[RXN-7609]]
 
* [[RXN-7614]]
 
* [[RXN-7948]]
 
* [[RXN-8730]]
 
* [[RXN-8748]]
 
* [[RXN-8988]]
 
* [[RXN-9]]
 
* [[RXN-9140]]
 
* [[RXN0-1061]]
 
* [[RXN0-2921]]
 
* [[RXN0-3542]]
 
* [[RXN0-4261]]
 
* [[RXN0-5073]]
 
* [[RXN0-5114]]
 
* [[RXN0-5187]]
 
* [[RXN0-5199]]
 
* [[RXN0-5408]]
 
* [[RXN0-5462]]
 
* [[RXN1F-20]]
 
* [[RXN1G-1435]]
 
* [[RXN1G-1436]]
 
* [[RXN1G-1437]]
 
* [[RXN1G-1438]]
 
* [[RXN1G-1439]]
 
* [[RXN1G-4355]]
 
* [[RXN3DJ-25]]
 
* [[RXN66-526]]
 
* [[RXN8J2-139]]
 
* [[RXNQT-4142]]
 
* [[S-ADENMETSYN-RXN]]
 
* [[SAICARSYN-RXN]]
 
* [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]]
 
* [[SUCCCOASYN-RXN]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
* [[SUGAR-PHOSPHATASE-RXN]]
 
* [[THIAMIN-TRIPHOSPHATASE-RXN]]
 
* [[THRESYN-RXN]]
 
* [[THYMIDINE-TRIPHOSPHATASE-RXN]]
 
* [[TPH]]
 
* [[TRANS-RXN-193]]
 
* [[TRANS-RXN-2]]
 
* [[TRANS-RXN-311]]
 
* [[TRANS-RXN0-470]]
 
* [[TREHALOSEPHOSPHA-RXN]]
 
* [[TRIPHOSPHATASE-RXN]]
 
* [[UMPP]]
 
* [[UMPU]]
 
* [[URA-PHOSPH-RXN]]
 
* [[URPHOS-RXN]]
 
* [[X5NT]]
 
* [[XMPXAN-RXN]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phosphate}}
+
{{#set: common-name=4-trans-undecenoyl-coa}}
{{#set: inchi-key=inchikey=nbiixxvuzaflbc-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=afmmiiqkxqnedn-dupkwvsksa-j}}
{{#set: molecular-weight=95.979}}
+
{{#set: molecular-weight=929.765}}

Revision as of 14:59, 5 January 2021

Metabolite CPD-15677

  • common-name:
    • 4-trans-undecenoyl-coa
  • smiles:
    • ccccccc=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • afmmiiqkxqnedn-dupkwvsksa-j
  • molecular-weight:
    • 929.765

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality