Difference between revisions of "CPD-13888"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9898 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
(Created page with "Category:metabolite == Metabolite NIACINE == * common-name: ** nicotinate * smiles: ** c1(=cc=c(c([o-])=o)c=n1) * inchi-key: ** pvniimvlhyawgp-uhfffaoysa-m * molecular-wei...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9898 ==
+
== Metabolite NIACINE ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate
+
** nicotinate
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
+
** c1(=cc=c(c([o-])=o)c=n1)
 
* inchi-key:
 
* inchi-key:
** fdppbyxdoxrdha-jsgwljpksa-m
+
** pvniimvlhyawgp-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 780.205
+
** 122.103
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9281]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate}}
+
{{#set: common-name=nicotinate}}
{{#set: inchi-key=inchikey=fdppbyxdoxrdha-jsgwljpksa-m}}
+
{{#set: inchi-key=inchikey=pvniimvlhyawgp-uhfffaoysa-m}}
{{#set: molecular-weight=780.205}}
+
{{#set: molecular-weight=122.103}}

Revision as of 14:55, 5 January 2021

Metabolite NIACINE

  • common-name:
    • nicotinate
  • smiles:
    • c1(=cc=c(c([o-])=o)c=n1)
  • inchi-key:
    • pvniimvlhyawgp-uhfffaoysa-m
  • molecular-weight:
    • 122.103

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality