Difference between revisions of "CPD-13927"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-TRYPTOPHAN == * common-name: ** 5-hydroxy-l-tryptophan * smiles: ** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+])) * inchi-key: ** l...") |
(Created page with "Category:metabolite == Metabolite CPD-13927 == * common-name: ** (z)-2-methylureidoacrylate peracid * smiles: ** cc(=cnc(n)=o)c(=o)oo * inchi-key: ** ghikatudzmbujc-ihwypq...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-13927 == |
* common-name: | * common-name: | ||
− | ** | + | ** (z)-2-methylureidoacrylate peracid |
* smiles: | * smiles: | ||
− | ** | + | ** cc(=cnc(n)=o)c(=o)oo |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ghikatudzmbujc-ihwypqmzsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 160.129 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12895]] |
+ | * [[RXN-12896]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(z)-2-methylureidoacrylate peracid}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ghikatudzmbujc-ihwypqmzsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=160.129}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-13927
- common-name:
- (z)-2-methylureidoacrylate peracid
- smiles:
- cc(=cnc(n)=o)c(=o)oo
- inchi-key:
- ghikatudzmbujc-ihwypqmzsa-n
- molecular-weight:
- 160.129