|
|
| (9 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIACYLGLYKIN-RXN DIACYLGLYKIN-RXN] == | + | == Metabolite CPD-14018 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** diacylglycerol kinase | + | ** icosapentaenoyl-coa |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.7.1.107 ec-2.7.1.107] | + | ** ccc=ccc=ccc=ccc=ccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[DIACYLGLYCEROL]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[L-PHOSPHATIDATE]][c] '''+''' 1 [[PROTON]][c]
| + | ** jwzlrycddxhxdl-lcmhirpzsa-j |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | ** 1047.943 |
| − | * Gene: [[SJ03368]]
| + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]]
| + | * [[RXN-13430]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[RXN-17688]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN-12978]] |
| − | * Gene: [[SJ04262]]
| + | * [[RXN-17688]] |
| − | ** Category: [[annotation]] | + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: common-name=icosapentaenoyl-coa}} |
| − | * Gene: [[SJ12057]]
| + | {{#set: inchi-key=inchikey=jwzlrycddxhxdl-lcmhirpzsa-j}} |
| − | ** Category: [[annotation]] | + | {{#set: molecular-weight=1047.943}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ12148]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ04791]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | * Gene: [[SJ16261]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY-7039]], phosphatidate metabolism, as a signaling molecule: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7039 PWY-7039] | |
| − | ** '''4''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-7817]], type I lipoteichoic acid biosynthesis (S. aureus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7817 PWY-7817] | |
| − | ** '''6''' reactions found over '''16''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10272 10272]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R02240 R02240]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q01583 Q01583]
| |
| − | ** [http://www.uniprot.org/uniprot/P49621 P49621]
| |
| − | ** [http://www.uniprot.org/uniprot/P49619 P49619]
| |
| − | ** [http://www.uniprot.org/uniprot/P51556 P51556]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JTJ7 Q9JTJ7]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CGK9 Q9CGK9]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PIN8 Q9PIN8]
| |
| − | ** [http://www.uniprot.org/uniprot/O08560 O08560]
| |
| − | ** [http://www.uniprot.org/uniprot/P0ABN1 P0ABN1]
| |
| − | ** [http://www.uniprot.org/uniprot/P20192 P20192]
| |
| − | ** [http://www.uniprot.org/uniprot/P23743 P23743]
| |
| − | ** [http://www.uniprot.org/uniprot/Q06119 Q06119]
| |
| − | ** [http://www.uniprot.org/uniprot/Q03603 Q03603]
| |
| − | ** [http://www.uniprot.org/uniprot/Q39017 Q39017]
| |
| − | ** [http://www.uniprot.org/uniprot/Q09103 Q09103]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=diacylglycerol kinase}} | |
| − | {{#set: ec-number=ec-2.7.1.107}} | |
| − | {{#set: nb gene associated=6}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
