|
|
| (7 intermediate revisions by 2 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRODIPICSYN-RXN DIHYDRODIPICSYN-RXN] == | + | == Metabolite CPD-14018 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** 4-hydroxy-tetrahydrodipicolinate synthase | + | ** icosapentaenoyl-coa |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/4.3.3.7 ec-4.3.3.7] | + | ** ccc=ccc=ccc=ccc=ccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | * synonymous:
| + | * inchi-key: |
| − | ** dihydropicolinate synthetase
| + | ** jwzlrycddxhxdl-lcmhirpzsa-j |
| − | ** dihydrodipicolinic acid synthase
| + | * molecular-weight: |
| − | == Reaction formula == | + | ** 1047.943 |
| − | * 1 [[L-ASPARTATE-SEMIALDEHYDE]][c] '''+''' 1 [[PYRUVATE]][c] '''=>''' 1 [[CPD-14443]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[WATER]][c]
| + | == Reaction(s) known to consume the compound == |
| − | == Gene(s) associated with this reaction == | + | * [[RXN-13430]] |
| − | * Gene: [[SJ18863]]
| + | * [[RXN-17688]] |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[RXN-12978]] |
| − | * Gene: [[SJ21231]] | + | * [[RXN-17688]] |
| − | ** Category: [[annotation]] | + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: common-name=icosapentaenoyl-coa}} |
| − | == Pathway(s) == | + | {{#set: inchi-key=inchikey=jwzlrycddxhxdl-lcmhirpzsa-j}} |
| − | * [[PWY-5097]], L-lysine biosynthesis VI: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5097 PWY-5097] | + | {{#set: molecular-weight=1047.943}} |
| − | ** '''7''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[DAPLYSINESYN-PWY]], L-lysine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=DAPLYSINESYN-PWY DAPLYSINESYN-PWY] | |
| − | ** '''7''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-2941]], L-lysine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2941 PWY-2941]
| |
| − | ** '''6''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-2942]], L-lysine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2942 PWY-2942]
| |
| − | ** '''6''' reactions found over '''7''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | == External links ==
| |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R10147 R10147]
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R02292 R02292]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P43797 P43797]
| |
| − | ** [http://www.uniprot.org/uniprot/O26892 O26892]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9Z6K9 Q9Z6K9]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9X1K9 Q9X1K9]
| |
| − | ** [http://www.uniprot.org/uniprot/P19808 P19808]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZM13 Q9ZM13]
| |
| − | ** [http://www.uniprot.org/uniprot/O05969 O05969]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CF61 Q9CF61]
| |
| − | ** [http://www.uniprot.org/uniprot/Q04796 Q04796]
| |
| − | ** [http://www.uniprot.org/uniprot/Q57695 Q57695]
| |
| − | ** [http://www.uniprot.org/uniprot/O25657 O25657]
| |
| − | ** [http://www.uniprot.org/uniprot/O67216 O67216]
| |
| − | ** [http://www.uniprot.org/uniprot/O29352 O29352]
| |
| − | ** [http://www.uniprot.org/uniprot/O84366 O84366]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PPB4 Q9PPB4]
| |
| − | ** [http://www.uniprot.org/uniprot/P63945 P63945]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JUU9 Q9JUU9]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9LZX6 Q9LZX6]
| |
| − | ** [http://www.uniprot.org/uniprot/Q43038 Q43038]
| |
| − | ** [http://www.uniprot.org/uniprot/P49423 P49423]
| |
| − | ** [http://www.uniprot.org/uniprot/Q55513 Q55513]
| |
| − | ** [http://www.uniprot.org/uniprot/P0A6L2 P0A6L2]
| |
| − | ** [http://www.uniprot.org/uniprot/Q42948 Q42948]
| |
| − | ** [http://www.uniprot.org/uniprot/Q42940 Q42940]
| |
| − | ** [http://www.uniprot.org/uniprot/O86841 O86841]
| |
| − | ** [http://www.uniprot.org/uniprot/P24847 P24847]
| |
| − | ** [http://www.uniprot.org/uniprot/P24846 P24846]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=4-hydroxy-tetrahydrodipicolinate synthase}} | |
| − | {{#set: ec-number=ec-4.3.3.7}} | |
| − | {{#set: synonymous=dihydropicolinate synthetase|dihydrodipicolinic acid synthase}} | |
| − | {{#set: nb gene associated=2}}
| |
| − | {{#set: nb pathway associated=4}}
| |
| − | {{#set: reconstruction category=annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
