Difference between revisions of "CPD-14115"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06091 == * transcription-direction: ** negative * right-end-position: ** 52643 * left-end-position: ** 33694 * centisome-position: ** 40.190853...")
(Created page with "Category:metabolite == Metabolite CPD-14115 == * common-name: ** (s)-equol * smiles: ** c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o) * inchi-key: ** adfcqwzhkcxpaj-gfccveg...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ06091 ==
+
== Metabolite CPD-14115 ==
* transcription-direction:
+
* common-name:
** negative
+
** (s)-equol
* right-end-position:
+
* smiles:
** 52643
+
** c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o)
* left-end-position:
+
* inchi-key:
** 33694
+
** adfcqwzhkcxpaj-gfccvegcsa-n
* centisome-position:
+
* molecular-weight:
** 40.190853   
+
** 242.274
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-15589]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
+
* [[RXN-15589]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(s)-equol}}
== Pathway(s) associated ==
+
{{#set: inchi-key=inchikey=adfcqwzhkcxpaj-gfccvegcsa-n}}
* [[TRIGLSYN-PWY]]
+
{{#set: molecular-weight=242.274}}
** '''5''' reactions found over '''7''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=52643}}
 
{{#set: left-end-position=33694}}
 
{{#set: centisome-position=40.190853    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-14115

  • common-name:
    • (s)-equol
  • smiles:
    • c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o)
  • inchi-key:
    • adfcqwzhkcxpaj-gfccvegcsa-n
  • molecular-weight:
    • 242.274

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality