Difference between revisions of "CPD-14122"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FADH2 == * common-name: ** fadh2 * smiles: ** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c...")
(Created page with "Category:metabolite == Metabolite CPD-14122 == * common-name: ** 2-deoxy-scyllo-inosamine * smiles: ** c1(c([n+])c(o)c(o)c(o)c(o)1) * inchi-key: ** qxqnrsuoynmxdl-kgjvwpdl...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FADH2 ==
+
== Metabolite CPD-14122 ==
 
* common-name:
 
* common-name:
** fadh2
+
** 2-deoxy-scyllo-inosamine
 
* smiles:
 
* smiles:
** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c=nc4(c(n)=nc=nc=45)))o6))=o)([o-])=o))
+
** c1(c([n+])c(o)c(o)c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** ypzrhbjkemoyqh-uybvjogssa-l
+
** qxqnrsuoynmxdl-kgjvwpdlsa-o
 
* molecular-weight:
 
* molecular-weight:
** 785.556
+
** 164.181
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACOAD1f]]
+
* [[RXN-13118]]
* [[PPCOAOm]]
 
* [[RXN-14264]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACOA120OR]]
 
* [[ACOA140OR]]
 
* [[ACOA160OR]]
 
* [[ACOA40OR]]
 
* [[ACOA80OR]]
 
* [[ACOAD1f]]
 
* [[IVCDH]]
 
* [[MCDH]]
 
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 
* [[PPCOAOm]]
 
* [[RXN-14264]]
 
* [[SUCDHm]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=fadh2}}
+
{{#set: common-name=2-deoxy-scyllo-inosamine}}
{{#set: inchi-key=inchikey=ypzrhbjkemoyqh-uybvjogssa-l}}
+
{{#set: inchi-key=inchikey=qxqnrsuoynmxdl-kgjvwpdlsa-o}}
{{#set: molecular-weight=785.556}}
+
{{#set: molecular-weight=164.181}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-14122

  • common-name:
    • 2-deoxy-scyllo-inosamine
  • smiles:
    • c1(c([n+])c(o)c(o)c(o)c(o)1)
  • inchi-key:
    • qxqnrsuoynmxdl-kgjvwpdlsa-o
  • molecular-weight:
    • 164.181

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality