Difference between revisions of "CPD-14122"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-PROPIONATE == * common-name: ** 3-hydroxypropanoate * smiles: ** c(co)c([o-])=o * inchi-key: ** alrhlsyjtwahjz-uhfffaoysa-m * m...") |
(Created page with "Category:metabolite == Metabolite CPD-14122 == * common-name: ** 2-deoxy-scyllo-inosamine * smiles: ** c1(c([n+])c(o)c(o)c(o)c(o)1) * inchi-key: ** qxqnrsuoynmxdl-kgjvwpdl...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14122 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-deoxy-scyllo-inosamine |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c1(c([n+])c(o)c(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qxqnrsuoynmxdl-kgjvwpdlsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 164.181 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-13118]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-deoxy-scyllo-inosamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qxqnrsuoynmxdl-kgjvwpdlsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=164.181}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-14122
- common-name:
- 2-deoxy-scyllo-inosamine
- smiles:
- c1(c([n+])c(o)c(o)c(o)c(o)1)
- inchi-key:
- qxqnrsuoynmxdl-kgjvwpdlsa-o
- molecular-weight:
- 164.181
