Difference between revisions of "CPD-14122"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06397 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * ATPASE-RXN ** Category...") |
(Created page with "Category:metabolite == Metabolite CPD-19491 == * common-name: ** 3-isopropyl-6-(methylthio)-2-oxohexanoate * smiles: ** c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-] * inchi-key: ** w...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-19491 == |
| − | == | + | * common-name: |
| − | * [[ | + | ** 3-isopropyl-6-(methylthio)-2-oxohexanoate |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-] |
| − | + | * inchi-key: | |
| − | + | ** wrgktdwhjsbcjr-uhfffaoysa-l | |
| − | {{#set: | + | * molecular-weight: |
| − | {{#set: | + | ** 218.224 |
| + | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-18208]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-18208]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=3-isopropyl-6-(methylthio)-2-oxohexanoate}} | ||
| + | {{#set: inchi-key=inchikey=wrgktdwhjsbcjr-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=218.224}} | ||
Revision as of 20:31, 18 December 2020
Contents
Metabolite CPD-19491
- common-name:
- 3-isopropyl-6-(methylthio)-2-oxohexanoate
- smiles:
- c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-]
- inchi-key:
- wrgktdwhjsbcjr-uhfffaoysa-l
- molecular-weight:
- 218.224
