Difference between revisions of "CPD-14123"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 34-DEHYDRO-14-THIOMORPHOLINE-3-CARBOXY == * common-name: ** 3,4-dehydrothiomorpholine-3-carboxylate * smiles: ** c1(cscc(=n1)c(=o)[o-]) *...")
(Created page with "Category:metabolite == Metabolite CPD-14123 == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * smiles: ** c1(c([n+])c(o)c(o)c(o)c(=o)1) * inchi-key: ** fsugckmutgkw...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 34-DEHYDRO-14-THIOMORPHOLINE-3-CARBOXY ==
+
== Metabolite CPD-14123 ==
 
* common-name:
 
* common-name:
** 3,4-dehydrothiomorpholine-3-carboxylate
+
** 3-amino-2,3-dideoxy-scyllo-inosose
 
* smiles:
 
* smiles:
** c1(cscc(=n1)c(=o)[o-])
+
** c1(c([n+])c(o)c(o)c(o)c(=o)1)
 
* inchi-key:
 
* inchi-key:
** hrxjcqxgahsujc-uhfffaoysa-m
+
** fsugckmutgkwie-ygivhsipsa-o
 
* molecular-weight:
 
* molecular-weight:
** 144.168
+
** 162.165
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.5.1.25-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13118]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dehydrothiomorpholine-3-carboxylate}}
+
{{#set: common-name=3-amino-2,3-dideoxy-scyllo-inosose}}
{{#set: inchi-key=inchikey=hrxjcqxgahsujc-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=fsugckmutgkwie-ygivhsipsa-o}}
{{#set: molecular-weight=144.168}}
+
{{#set: molecular-weight=162.165}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-14123

  • common-name:
    • 3-amino-2,3-dideoxy-scyllo-inosose
  • smiles:
    • c1(c([n+])c(o)c(o)c(o)c(=o)1)
  • inchi-key:
    • fsugckmutgkwie-ygivhsipsa-o
  • molecular-weight:
    • 162.165

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality