Difference between revisions of "CPD-14123"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SPERMINE == * common-name: ** spermine * smiles: ** c(ccc[n+]ccc[n+])[n+]ccc[n+] * inchi-key: ** pfnffqxmrsdohw-uhfffaoysa-r * molecular-...") |
(Created page with "Category:metabolite == Metabolite CPD-14123 == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * smiles: ** c1(c([n+])c(o)c(o)c(o)c(=o)1) * inchi-key: ** fsugckmutgkw...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14123 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-amino-2,3-dideoxy-scyllo-inosose |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c1(c([n+])c(o)c(o)c(o)c(=o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fsugckmutgkwie-ygivhsipsa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 162.165 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13118]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-amino-2,3-dideoxy-scyllo-inosose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fsugckmutgkwie-ygivhsipsa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=162.165}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-14123
- common-name:
- 3-amino-2,3-dideoxy-scyllo-inosose
- smiles:
- c1(c([n+])c(o)c(o)c(o)c(=o)1)
- inchi-key:
- fsugckmutgkwie-ygivhsipsa-o
- molecular-weight:
- 162.165
