Difference between revisions of "CPD-14123"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SPERMINE == * common-name: ** spermine * smiles: ** c(ccc[n+]ccc[n+])[n+]ccc[n+] * inchi-key: ** pfnffqxmrsdohw-uhfffaoysa-r * molecular-...")
(Created page with "Category:metabolite == Metabolite CPD66-29 == * common-name: ** 5-androstene-3,17-dione * smiles: ** cc24(ccc(=o)cc(=cc[ch]1([ch]3(ccc(=o)c(cc[ch]12)(c)3)))4) * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SPERMINE ==
+
== Metabolite CPD66-29 ==
 
* common-name:
 
* common-name:
** spermine
+
** 5-androstene-3,17-dione
 
* smiles:
 
* smiles:
** c(ccc[n+]ccc[n+])[n+]ccc[n+]
+
** cc24(ccc(=o)cc(=cc[ch]1([ch]3(ccc(=o)c(cc[ch]12)(c)3)))4)
 
* inchi-key:
 
* inchi-key:
** pfnffqxmrsdohw-uhfffaoysa-r
+
** sqgzfritsmykrh-qaggrknesa-n
 
* molecular-weight:
 
* molecular-weight:
** 206.374
+
** 286.413
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN66-342]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SPERMINE-SYNTHASE-RXN]]
+
* [[RXN66-342]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=spermine}}
+
{{#set: common-name=5-androstene-3,17-dione}}
{{#set: inchi-key=inchikey=pfnffqxmrsdohw-uhfffaoysa-r}}
+
{{#set: inchi-key=inchikey=sqgzfritsmykrh-qaggrknesa-n}}
{{#set: molecular-weight=206.374}}
+
{{#set: molecular-weight=286.413}}

Revision as of 13:11, 14 January 2021

Metabolite CPD66-29

  • common-name:
    • 5-androstene-3,17-dione
  • smiles:
    • cc24(ccc(=o)cc(=cc[ch]1([ch]3(ccc(=o)c(cc[ch]12)(c)3)))4)
  • inchi-key:
    • sqgzfritsmykrh-qaggrknesa-n
  • molecular-weight:
    • 286.413

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality