Difference between revisions of "CPD-14154"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08289 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PNKIN-RXN ** Category:...") |
(Created page with "Category:metabolite == Metabolite CPD-14154 == * common-name: ** tobramycin * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o...") |
||
| (7 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-14154 == |
| − | + | * common-name: | |
| − | * | + | ** tobramycin |
| − | + | * smiles: | |
| − | * | + | ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o) |
| − | * | + | * inchi-key: |
| − | ** | + | ** nlvfbuxfdbbnbw-pbsuhmdjsa-s |
| − | * | + | * molecular-weight: |
| − | + | ** 472.558 | |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-13168]] |
| − | + | * [[RXN-15284]] | |
| − | ** | + | == Reaction(s) known to produce the compound == |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | {{#set: common-name=tobramycin}} |
| − | + | {{#set: inchi-key=inchikey=nlvfbuxfdbbnbw-pbsuhmdjsa-s}} | |
| − | * [[ | + | {{#set: molecular-weight=472.558}} |
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-14154
- common-name:
- tobramycin
- smiles:
- c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)co))o))[n+])o)
- inchi-key:
- nlvfbuxfdbbnbw-pbsuhmdjsa-s
- molecular-weight:
- 472.558
