Difference between revisions of "CPD-14158"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19806 == * transcription-direction: ** negative * right-end-position: ** 113146 * left-end-position: ** 110136 * centisome-position: ** 50.090736...") |
(Created page with "Category:metabolite == Metabolite CPD-10269 == * common-name: ** palmitoleoyl-coa * smiles: ** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-10269 == |
| − | * | + | * common-name: |
| − | ** | + | ** palmitoleoyl-coa |
| − | + | * smiles: | |
| − | + | ** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
| − | * | + | * inchi-key: |
| − | ** | + | ** qbyoccwnzaoztl-mdmkaecgsa-j |
| − | + | * molecular-weight: | |
| − | + | ** 999.899 | |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-10662]] | |
| − | = | + | * [[RXN-17008]] |
| − | + | * [[RXN-17009]] | |
| − | + | * [[RXN-17019]] | |
| − | * | + | * [[RXN-17788]] |
| − | ** | + | * [[RXN-9616]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-10664]] |
| − | ** | + | * [[RXN-17787]] |
| − | * [[RXN- | + | * [[RXN0-7248]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=palmitoleoyl-coa}} | |
| − | * [[RXN- | + | {{#set: inchi-key=inchikey=qbyoccwnzaoztl-mdmkaecgsa-j}} |
| − | + | {{#set: molecular-weight=999.899}} | |
| − | |||
| − | * [[RXN- | ||
| − | * | ||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | * [[ | ||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-10269
- common-name:
- palmitoleoyl-coa
- smiles:
- ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- qbyoccwnzaoztl-mdmkaecgsa-j
- molecular-weight:
- 999.899
