Difference between revisions of "CPD-14159"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Angiotensinogens == * common-name: ** an angiotensinogen == Reaction(s) known to consume the compound == * 3.4.23.15-RXN == Reaction(...") |
(Created page with "Category:metabolite == Metabolite CPD-14159 == * common-name: ** 6''-o-carbamoylkanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-14159 == |
* common-name: | * common-name: | ||
− | ** | + | ** 6''-o-carbamoylkanamycin b |
+ | * smiles: | ||
+ | ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+])) | ||
+ | * inchi-key: | ||
+ | ** xcstznjiqfivpe-fqsmhnglsa-s | ||
+ | * molecular-weight: | ||
+ | ** 531.582 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14553]] | ||
+ | * [[RXN-15287]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=6''-o-carbamoylkanamycin b}} |
+ | {{#set: inchi-key=inchikey=xcstznjiqfivpe-fqsmhnglsa-s}} | ||
+ | {{#set: molecular-weight=531.582}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-14159
- common-name:
- 6-o-carbamoylkanamycin b
- smiles:
- c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
- inchi-key:
- xcstznjiqfivpe-fqsmhnglsa-s
- molecular-weight:
- 531.582