Difference between revisions of "CPD-14159"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04223 == * transcription-direction: ** negative * right-end-position: ** 108409 * left-end-position: ** 101345 * centisome-position: ** 92.71932...") |
(Created page with "Category:metabolite == Metabolite CPD-14159 == * common-name: ** 6''-o-carbamoylkanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-14159 == |
− | * | + | * common-name: |
− | ** | + | ** 6''-o-carbamoylkanamycin b |
− | + | * smiles: | |
− | + | ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+])) | |
− | * | + | * inchi-key: |
− | ** | + | ** xcstznjiqfivpe-fqsmhnglsa-s |
− | + | * molecular-weight: | |
− | + | ** 531.582 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-14553]] | |
− | + | * [[RXN-15287]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=6''-o-carbamoylkanamycin b}} | |
− | + | {{#set: inchi-key=inchikey=xcstznjiqfivpe-fqsmhnglsa-s}} | |
− | + | {{#set: molecular-weight=531.582}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-14159
- common-name:
- 6-o-carbamoylkanamycin b
- smiles:
- c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
- inchi-key:
- xcstznjiqfivpe-fqsmhnglsa-s
- molecular-weight:
- 531.582