Difference between revisions of "CPD-14159"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Glutaryl-ACP-methyl-esters == * common-name: ** a glutaryl-[acp] methyl ester == Reaction(s) known to consume the compound == * RXN-114...") |
(Created page with "Category:metabolite == Metabolite CPD-14808 == * common-name: ** scyllo-inosose * smiles: ** c1(c(c(c(c(c1o)o)=o)o)o)o * inchi-key: ** vyegbdhsghxogt-hyfglkjpsa-n * molecu...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14808 == |
* common-name: | * common-name: | ||
| − | ** | + | ** scyllo-inosose |
| + | * smiles: | ||
| + | ** c1(c(c(c(c(c1o)o)=o)o)o)o | ||
| + | * inchi-key: | ||
| + | ** vyegbdhsghxogt-hyfglkjpsa-n | ||
| + | * molecular-weight: | ||
| + | ** 178.141 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]] |
| + | * [[RXN-13779]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]] |
| + | * [[RXN-13779]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=scyllo-inosose}} |
| + | {{#set: inchi-key=inchikey=vyegbdhsghxogt-hyfglkjpsa-n}} | ||
| + | {{#set: molecular-weight=178.141}} | ||
Revision as of 18:55, 14 January 2021
Contents
Metabolite CPD-14808
- common-name:
- scyllo-inosose
- smiles:
- c1(c(c(c(c(c1o)o)=o)o)o)o
- inchi-key:
- vyegbdhsghxogt-hyfglkjpsa-n
- molecular-weight:
- 178.141
