Difference between revisions of "CPD-14202"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13682 RXN-13682] == * direction: ** reversible * common-name: ** 3-oxo-5-alpha-steroid 4-dehydr...") |
(Created page with "Category:metabolite == Metabolite CPD-14202 == * common-name: ** l-erythro-7,8-dihydrobiopterin * smiles: ** cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n)) * inchi-key: ** femxzdut...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-14202 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** l-erythro-7,8-dihydrobiopterin |
| − | * | + | * smiles: |
| − | ** | + | ** cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n)) |
| − | == | + | * inchi-key: |
| − | * | + | ** femxzdutfrtwpe-dzswipipsa-n |
| − | == | + | * molecular-weight: |
| − | * | + | ** 239.233 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[SEPIAPTERIN-REDUCTASE-RXN]] | |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-7908]] | |
| − | * | + | * [[SEPIAPTERIN-REDUCTASE-RXN]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=l-erythro-7,8-dihydrobiopterin}} | |
| − | {{#set: common-name= | + | {{#set: inchi-key=inchikey=femxzdutfrtwpe-dzswipipsa-n}} |
| − | {{#set: | + | {{#set: molecular-weight=239.233}} |
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-14202
- common-name:
- l-erythro-7,8-dihydrobiopterin
- smiles:
- cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n))
- inchi-key:
- femxzdutfrtwpe-dzswipipsa-n
- molecular-weight:
- 239.233
