Difference between revisions of "CPD-14202"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8563 == * common-name: ** a [myosin light-chain] l-serine phosphate phosphate == Reaction(s) known to consume the compound == * 2.7...")
(Created page with "Category:metabolite == Metabolite CPD-14202 == * common-name: ** l-erythro-7,8-dihydrobiopterin * smiles: ** cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n)) * inchi-key: ** femxzdut...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8563 ==
+
== Metabolite CPD-14202 ==
 
* common-name:
 
* common-name:
** a [myosin light-chain] l-serine phosphate phosphate
+
** l-erythro-7,8-dihydrobiopterin
 +
* smiles:
 +
** cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n))
 +
* inchi-key:
 +
** femxzdutfrtwpe-dzswipipsa-n
 +
* molecular-weight:
 +
** 239.233
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.11.18-RXN]]
+
* [[SEPIAPTERIN-REDUCTASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.11.18-RXN]]
+
* [[RXN-7908]]
 +
* [[SEPIAPTERIN-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [myosin light-chain] l-serine phosphate phosphate}}
+
{{#set: common-name=l-erythro-7,8-dihydrobiopterin}}
 +
{{#set: inchi-key=inchikey=femxzdutfrtwpe-dzswipipsa-n}}
 +
{{#set: molecular-weight=239.233}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-14202

  • common-name:
    • l-erythro-7,8-dihydrobiopterin
  • smiles:
    • cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n))
  • inchi-key:
    • femxzdutfrtwpe-dzswipipsa-n
  • molecular-weight:
    • 239.233

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality