Difference between revisions of "CPD-14202"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite C3 == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine * smiles: ** cc(c(=o)nc(c(...")
(Created page with "Category:metabolite == Metabolite CPD-8563 == * common-name: ** a [myosin light-chain] l-serine phosphate phosphate == Reaction(s) known to consume the compound == * 2.7...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite C3 ==
+
== Metabolite CPD-8563 ==
 
* common-name:
 
* common-name:
** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine
+
** a [myosin light-chain] l-serine phosphate phosphate
* smiles:
 
** cc(c(=o)nc(c([o-])=o)c)nc(=o)c(cccc[n+])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op(op(occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)([o-])=o)
 
* inchi-key:
 
** pfmvormcvgoqkr-xncokrrhsa-k
 
* molecular-weight:
 
** 1146.922
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8975]]
+
* [[2.7.11.18-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8975]]
+
* [[2.7.11.18-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine}}
+
{{#set: common-name=a [myosin light-chain] l-serine phosphate phosphate}}
{{#set: inchi-key=inchikey=pfmvormcvgoqkr-xncokrrhsa-k}}
 
{{#set: molecular-weight=1146.922}}
 

Revision as of 14:59, 5 January 2021

Metabolite CPD-8563

  • common-name:
    • a [myosin light-chain] l-serine phosphate phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [myosin light-chain] l-serine phosphate phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.