Difference between revisions of "CPD-14202"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8563 == * common-name: ** a [myosin light-chain] l-serine phosphate phosphate == Reaction(s) known to consume the compound == * 2.7...")
(Created page with "Category:metabolite == Metabolite CPD-11690 == * common-name: ** 1-oleoyl-sn-glycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(co)o * inchi-key: ** rzrnayuhwvfmip-qjrazlaks...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8563 ==
+
== Metabolite CPD-11690 ==
 
* common-name:
 
* common-name:
** a [myosin light-chain] l-serine phosphate phosphate
+
** 1-oleoyl-sn-glycerol
 +
* smiles:
 +
** ccccccccc=ccccccccc(=o)occ(co)o
 +
* inchi-key:
 +
** rzrnayuhwvfmip-qjrazlaksa-n
 +
* molecular-weight:
 +
** 356.545
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.11.18-RXN]]
+
* [[RXN-15089]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.11.18-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [myosin light-chain] l-serine phosphate phosphate}}
+
{{#set: common-name=1-oleoyl-sn-glycerol}}
 +
{{#set: inchi-key=inchikey=rzrnayuhwvfmip-qjrazlaksa-n}}
 +
{{#set: molecular-weight=356.545}}

Revision as of 15:29, 5 January 2021

Metabolite CPD-11690

  • common-name:
    • 1-oleoyl-sn-glycerol
  • smiles:
    • ccccccccc=ccccccccc(=o)occ(co)o
  • inchi-key:
    • rzrnayuhwvfmip-qjrazlaksa-n
  • molecular-weight:
    • 356.545

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality