Difference between revisions of "CPD-14269"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ASN == * common-name: ** l-asparagine * smiles: ** c(cc(c(=o)[o-])[n+])(n)=o * inchi-key: ** dcxyfedjocdnaf-reohclbhsa-n * molecular-weig...")
(Created page with "Category:metabolite == Metabolite CPD-14269 == * common-name: ** (z)-15-tetracosenoyl-coa * smiles: ** ccccccccc=ccccccccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ASN ==
+
== Metabolite CPD-14269 ==
 
* common-name:
 
* common-name:
** l-asparagine
+
** (z)-15-tetracosenoyl-coa
 
* smiles:
 
* smiles:
** c(cc(c(=o)[o-])[n+])(n)=o
+
** ccccccccc=ccccccccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
* inchi-key:
** dcxyfedjocdnaf-reohclbhsa-n
+
** qhzaqvtvyphlkk-yvbaagqksa-j
 
* molecular-weight:
 
* molecular-weight:
** 132.119
+
** 1112.113
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPARAGHYD-RXN]]
 
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ASNSYNA-RXN]]
+
* [[RXN-13290]]
* [[ASNSYNB-RXN]]
 
* [[RXN-12460]]
 
* [[RXN0-6982]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-asparagine}}
+
{{#set: common-name=(z)-15-tetracosenoyl-coa}}
{{#set: inchi-key=inchikey=dcxyfedjocdnaf-reohclbhsa-n}}
+
{{#set: inchi-key=inchikey=qhzaqvtvyphlkk-yvbaagqksa-j}}
{{#set: molecular-weight=132.119}}
+
{{#set: molecular-weight=1112.113}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-14269

  • common-name:
    • (z)-15-tetracosenoyl-coa
  • smiles:
    • ccccccccc=ccccccccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • qhzaqvtvyphlkk-yvbaagqksa-j
  • molecular-weight:
    • 1112.113

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality