Difference between revisions of "CPD-14270"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-CHLORO-24-DINITROBENZENE == * common-name: ** 1-chloro-2,4-dinitrobenzene * smiles: ** c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o) * in...") |
(Created page with "Category:metabolite == Metabolite CPD-14270 == * common-name: ** dodecyl icosanoate * smiles: ** cccccccccccccccccccc(occcccccccccc)=o * inchi-key: ** gffyhzlidinabp-uhfff...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14270 == |
* common-name: | * common-name: | ||
| − | ** | + | ** dodecyl icosanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccccccccccc(occcccccccccc)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gffyhzlidinabp-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 480.856 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9356]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9356]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dodecyl icosanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gffyhzlidinabp-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=480.856}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-14270
- common-name:
- dodecyl icosanoate
- smiles:
- cccccccccccccccccccc(occcccccccccc)=o
- inchi-key:
- gffyhzlidinabp-uhfffaoysa-n
- molecular-weight:
- 480.856
