Difference between revisions of "CPD-14270"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PLASTOQUINONE == * common-name: ** a plastoquinone == Reaction(s) known to consume the compound == * PSII-RXN * RXN-11355 * RXN...") |
(Created page with "Category:metabolite == Metabolite CPD-596 == * common-name: ** n6,n6-dimethyl-l-arginine * smiles: ** cn(c(=[n+])ncccc([n+])c(=o)[o-])c * inchi-key: ** ydgmgexadbmomj-lurj...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-596 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n6,n6-dimethyl-l-arginine |
| + | * smiles: | ||
| + | ** cn(c(=[n+])ncccc([n+])c(=o)[o-])c | ||
| + | * inchi-key: | ||
| + | ** ydgmgexadbmomj-lurjtmiesa-o | ||
| + | * molecular-weight: | ||
| + | ** 203.264 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DIMETHYLARGININASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n6,n6-dimethyl-l-arginine}} |
| + | {{#set: inchi-key=inchikey=ydgmgexadbmomj-lurjtmiesa-o}} | ||
| + | {{#set: molecular-weight=203.264}} | ||
Revision as of 15:29, 5 January 2021
Contents
Metabolite CPD-596
- common-name:
- n6,n6-dimethyl-l-arginine
- smiles:
- cn(c(=[n+])ncccc([n+])c(=o)[o-])c
- inchi-key:
- ydgmgexadbmomj-lurjtmiesa-o
- molecular-weight:
- 203.264
