Difference between revisions of "CPD-14275"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE == * common-name: ** s-adenosyl-4-methylthio-2-oxobutanoate * smiles: ** c[s+](ccc(c([o-])=o)=o)cc...") |
(Created page with "Category:metabolite == Metabolite CPD-5662 == * common-name: ** 9-mercaptodethiobiotin * smiles: ** c(s)c1(c(nc(n1)=o)cccccc(=o)[o-]) * inchi-key: ** zarfdbykhcotrh-uhfffa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-5662 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 9-mercaptodethiobiotin |
* smiles: | * smiles: | ||
| − | ** c | + | ** c(s)c1(c(nc(n1)=o)cccccc(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zarfdbykhcotrh-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 245.316 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17473]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17472]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=9-mercaptodethiobiotin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zarfdbykhcotrh-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=245.316}} |
Revision as of 11:14, 15 January 2021
Contents
Metabolite CPD-5662
- common-name:
- 9-mercaptodethiobiotin
- smiles:
- c(s)c1(c(nc(n1)=o)cccccc(=o)[o-])
- inchi-key:
- zarfdbykhcotrh-uhfffaoysa-m
- molecular-weight:
- 245.316
