Difference between revisions of "CPD-14275"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5662 == * common-name: ** 9-mercaptodethiobiotin * smiles: ** c(s)c1(c(nc(n1)=o)cccccc(=o)[o-]) * inchi-key: ** zarfdbykhcotrh-uhfffa...") |
(Created page with "Category:metabolite == Metabolite CPD-1789 == * common-name: ** dehydro-d-arabinono-1,4-lactone * smiles: ** c(o)c1(c(o)=c(o)c(=o)o1) * inchi-key: ** zzzcuofihgpkak-uwtatz...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-1789 == |
* common-name: | * common-name: | ||
| − | ** | + | ** dehydro-d-arabinono-1,4-lactone |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(o)c1(c(o)=c(o)c(=o)o1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zzzcuofihgpkak-uwtatzphsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 146.099 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[1.1.3.37-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dehydro-d-arabinono-1,4-lactone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zzzcuofihgpkak-uwtatzphsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=146.099}} |
Revision as of 08:26, 15 March 2021
Contents
Metabolite CPD-1789
- common-name:
- dehydro-d-arabinono-1,4-lactone
- smiles:
- c(o)c1(c(o)=c(o)c(=o)o1)
- inchi-key:
- zzzcuofihgpkak-uwtatzphsa-n
- molecular-weight:
- 146.099
