Difference between revisions of "CPD-14275"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5662 == * common-name: ** 9-mercaptodethiobiotin * smiles: ** c(s)c1(c(nc(n1)=o)cccccc(=o)[o-]) * inchi-key: ** zarfdbykhcotrh-uhfffa...")
(Created page with "Category:metabolite == Metabolite CPD-14275 == * common-name: ** (3r)-3-hydroxy-arachidoyl-coa * smiles: ** cccccccccccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-5662 ==
+
== Metabolite CPD-14275 ==
 
* common-name:
 
* common-name:
** 9-mercaptodethiobiotin
+
** (3r)-3-hydroxy-arachidoyl-coa
 
* smiles:
 
* smiles:
** c(s)c1(c(nc(n1)=o)cccccc(=o)[o-])
+
** cccccccccccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
* inchi-key:
** zarfdbykhcotrh-uhfffaoysa-m
+
** knsvymfejlujst-afmyzwiisa-j
 
* molecular-weight:
 
* molecular-weight:
** 245.316
+
** 1074.021
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17473]]
+
* [[RXN-13302]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17472]]
+
* [[RXN-13298]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=9-mercaptodethiobiotin}}
+
{{#set: common-name=(3r)-3-hydroxy-arachidoyl-coa}}
{{#set: inchi-key=inchikey=zarfdbykhcotrh-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=knsvymfejlujst-afmyzwiisa-j}}
{{#set: molecular-weight=245.316}}
+
{{#set: molecular-weight=1074.021}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-14275

  • common-name:
    • (3r)-3-hydroxy-arachidoyl-coa
  • smiles:
    • cccccccccccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • knsvymfejlujst-afmyzwiisa-j
  • molecular-weight:
    • 1074.021

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality