Difference between revisions of "CPD-14275"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7880 == * common-name: ** dodecanal * smiles: ** ccccccccccc[ch]=o * inchi-key: ** hfjrkmmybmwead-uhfffaoysa-n * molecular-weight: **...") |
(Created page with "Category:metabolite == Metabolite S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE == * common-name: ** s-adenosyl-4-methylthio-2-oxobutanoate * smiles: ** c[s+](ccc(c([o-])=o)=o)cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-adenosyl-4-methylthio-2-oxobutanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** c[s+](ccc(c([o-])=o)=o)cc1(oc(c(c1o)o)n3(c2(=nc=nc(=c2n=c3)n))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uokvqqmbgvmxpu-cjpdyehrsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 397.405 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[DAPASYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[DAPASYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-adenosyl-4-methylthio-2-oxobutanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uokvqqmbgvmxpu-cjpdyehrsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=397.405}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite S-ADENOSYL-4-METHYLTHIO-2-OXOBUTANOATE
- common-name:
- s-adenosyl-4-methylthio-2-oxobutanoate
- smiles:
- c[s+](ccc(c([o-])=o)=o)cc1(oc(c(c1o)o)n3(c2(=nc=nc(=c2n=c3)n)))
- inchi-key:
- uokvqqmbgvmxpu-cjpdyehrsa-n
- molecular-weight:
- 397.405
