Difference between revisions of "CPD-14277"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite S-ubiquitinyl-UCP-E2-L-cysteine == * common-name: ** an [e2 ubiquitin-conjugating enzyme]-s-ubiquitinyl-l-cysteine == Reaction(s) known t...") |
(Created page with "Category:metabolite == Metabolite CPD-17638 == * common-name: ** 7-hydroxylauroyl-coa * smiles: ** cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17638 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7-hydroxylauroyl-coa |
| + | * smiles: | ||
| + | ** cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** rxedusgpuqqzew-xirpngcasa-j | ||
| + | * molecular-weight: | ||
| + | ** 961.807 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12184]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7-hydroxylauroyl-coa}} |
| + | {{#set: inchi-key=inchikey=rxedusgpuqqzew-xirpngcasa-j}} | ||
| + | {{#set: molecular-weight=961.807}} | ||
Revision as of 11:13, 15 January 2021
Contents
Metabolite CPD-17638
- common-name:
- 7-hydroxylauroyl-coa
- smiles:
- cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- rxedusgpuqqzew-xirpngcasa-j
- molecular-weight:
- 961.807
