Difference between revisions of "CPD-14278"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite NIACINE == * common-name: ** nicotinate * smiles: ** c1(=cc=c(c([o-])=o)c=n1) * inchi-key: ** pvniimvlhyawgp-uhfffaoysa-m * molecular-wei...") |
(Created page with "Category:metabolite == Metabolite CPD-308 == * common-name: ** d-nopaline * smiles: ** c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o * inchi-key: ** lmkyzbgvkhtlt...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-308 == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-nopaline |
* smiles: | * smiles: | ||
| − | ** | + | ** c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lmkyzbgvkhtltn-nkwvepmbsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 303.294 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[1.5.1.19-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-nopaline}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lmkyzbgvkhtltn-nkwvepmbsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=303.294}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-308
- common-name:
- d-nopaline
- smiles:
- c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o
- inchi-key:
- lmkyzbgvkhtltn-nkwvepmbsa-m
- molecular-weight:
- 303.294
